Реакция #742247

ord-bcdbe9d06ac24788803249188b793775

Уравнение реакции

CCOC(=O)/C(C)=C/c1ccccc1O
(E)-3-(2-hydroxy-phenyl)-2-methyl-acrylic acid ethyl ester
[K+].[OH-]
potassium hydroxide
[K+].[OH-]
potassium hydroxide
C/C(=C\c1ccccc1O)C(=O)O
(E)-3(2-Hydroxy-phenyl)-2-methyl-acrylic acid

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    ТемператураAfter refluxing for 5 hours
  2. 2
    Температураwas refluxed for another 19 hours
  3. 3
    ТемператураThen the reaction mixture was cooled down
  4. 4
    Промывкаwashed to pH 4 with HCl 2N and water
  5. 5
    ДругоеThe organic phase was dried
  6. 6
    Фильтрацияfiltered
  7. 7
    Другоеevaporated to dryness

Методика

To a solution of 35.5 g of (E)-3-(2-hydroxy-phenyl)-2-methyl-acrylic acid ethyl ester in 600 ml of ethanol, a solution of 10.66 g of potassium hydroxide in 500 ml of water was dropped in. After refluxing for 5 hours, another 5.0 g of potassium hydroxide was put in and the mixture was refluxed for another 19 hours. Then the reaction mixture was cooled down, diluted with ether and washed to pH 4 with HCl 2N and water. The organic phase was dried, filtered and evaporated to dryness. The resulting colourless crystals were not further purified.

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: USRE043006E1uspto-grants-2011_12