Реакция #645235

ord-c00a6d597c4c4eb7adab089966690693

Уравнение реакции

CC(=S)OC(OC(=O)C(C)C)C(C)C
2-methyl-1-methylthiocarbonyloxypropyl 2-methylpropanoate
CC(=S)OC(OC(=O)C(C)C)C(C)C
2-Methyl-1-methylthiocarbonyloxypropyl 2-methylpropanoate
O[C@H](c1c2ccccc2cc2ccccc12)C(F)(F)F
(R)-(−)-2,2,2-trifluoro-1-(9-anthryl)ethanol
CC(=S)O[C@@H](OC(=O)C(C)C)C(C)C
title compound ( 4 )
Выход 24.3%
CC(=S)O[C@@H](OC(=O)C(C)C)C(C)C
(1R)-2-Methyl-1-methylthiocarbonyloxypropyl 2-methylpropanoate
Выход 24.3%

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    workup.STIRRINGThe reaction was stirred overnight
  2. 2
    Другоеthe ether layer separated
  3. 3
    Фильтрацияfiltered through a pad of CELITE® 545
  4. 4
    Другоеto remove the enzyme
  5. 5
    ПромывкаThe ether layer was washed with aqueous sodium bicarbonate (NaHCO3) (5 times) and brine
  6. 6
    Сушкаdried over anhydrous sodium sulfate (Na2SO4)
  7. 7
    ДругоеAfter rotary evaporation
  8. 8
    Другоеto remove the solvent

Методика

A mixture of 2-methyl-1-methylthiocarbonyloxypropyl 2-methylpropanoate (2b) (125 g) and lipase from Candida rugosa (Sigma-Aldrich) (12.5 g) in pH 7.2 phosphate buffered saline (1 L) was stirred at room temperature. The reaction was monitored by 1H-NMR using the chiral solvating agent (R)-(−)-2,2,2-trifluoro-1-(9-anthryl)ethanol. The reaction was stirred overnight. The reaction mixture was then diluted with ether, and the ether layer separated and filtered through a pad of CELITE® 545 to remove the enzyme. The ether layer was washed with aqueous sodium bicarbonate (NaHCO3) (5 times) and brine, and dried over anhydrous sodium sulfate (Na2SO4). After rotary evaporation to remove the solvent, 30.4 g of the title compound (4) was obtained. 1H-NMR using a chiral solvating agent confirmed the presence of a single isomer. The absolute configuration was determined by derivatization to a compound having known stereochemistry. 1H-NMR (CDCl3): δ 0.96 (d, J=6.8 Hz, 6H), 1.16 (d, J=6.8 Hz, 3H), 1.17 (d, J=6.8 Hz, 3H), 1.98-2.07 (m, 1H), 2.32 (s, 3H), 2.56 (septet, J=7.2 Hz, 1H), 6.67 (d, J=5.6 Hz, 1H) ppm.

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US08062870B2uspto-grants-2011_11