Реакция #640559

ord-7a195b115e354b77a085f722371f1b31

Уравнение реакции

O=C(O)C(=O)Cc1ccccc1
Phenyl pyruvic acid
O=C(O)CC(=O)C(=O)O
oxaloacetic acid
[K+].[OH-]
potassium hydroxide
Cl
hydrochloric acid
O=C(O)C(=O)CC(O)(Cc1ccccc1)C(=O)O
4-phenylmethyl-4-hydroxy-2-ketoglutaric acid
Выход 37.0%

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    workup.DISSOLUTIONhad been dissolved
  2. 2
    Другоеreacted at room temperature for 72 hours
  3. 3
    Экстракцияthe reaction mixture was extracted with ethyl acetate
  4. 4
    ПромывкаAn organic layer was washed with saturated aqueous NaCl solution
  5. 5
    Другоеdried on magnesium sulfate anhydrate
  6. 6
    Концентрированиеconcentrated
  7. 7
    Другоеto yield residue
  8. 8
    ДругоеThe residue was recrystallized from ethyl acetate and toluene

Методика

Phenyl pyruvic acid (5.0 g, 30.5 mmol) and 12.1 g (91.4 mmol) of oxaloacetic acid were added to 25 mL of aqueous solution in which 13.8 g of potassium hydroxide (purity 85%) had been dissolved, and reacted at room temperature for 72 hours. A pH value of the reaction mixture was adjusted to 2.2 using concentrated hydrochloric acid, and the reaction mixture was extracted with ethyl acetate. An organic layer was washed with saturated aqueous NaCl solution, dried on magnesium sulfate anhydrate, and then concentrated to yield residue. The residue was recrystallized from ethyl acetate and toluene to yield 2.8 g (11.3 mmol) of 4-phenylmethyl-4-hydroxy-2-ketoglutaric acid as crystal.

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US08048647B2uspto-grants-2011_11