Реакция #586136

ord-56146754b79b458583b98711961271b0

Уравнение реакции

O=C([O-])O.[Na+]
sodium bicarbonate
CC(C)Sc1cccc(-c2ccc(Cl)cc2Cl)c1
[3-(2,4-dichlorophenyl)phenyl] isopropyl sulfide
O=C(OO)c1cccc(Cl)c1
m-chloroperbenzoic acid
CC(C)S(=O)c1cccc(-c2ccc(Cl)cc2Cl)c1
[3-(2,4-dichlorophenyl)phenyl] isopropyl sulfoxide
Выход 85.0%

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    workup.STIRRINGthe reaction mixture was stirred for 2 hours
  2. 2
    workup.STIRRINGThe reaction mixture was stirred at room temperature for another 12 hours
  3. 3
    ПромывкаThe chloroform layer was washed with 5% aqueous sodium sulfite and water
  4. 4
    Сушкаdried over anhydrous magnesium sulfate
  5. 5
    workup.DISTILLATIONthe solvent was distilled off under reduced pressure
  6. 6
    ДругоеPurification of the residue by silica gel column chromatography

Методика

To 1.0 g (3.4 mmol) of [3-(2,4-dichlorophenyl)phenyl] isopropyl sulfide in 50 ml of chloroform, 0.7 g (4.1 mmol) of m-chloroperbenzoic acid was added at 0° C. with stirring, and the reaction mixture was stirred for 2 hours. The reaction mixture was stirred at room temperature for another 12 hours, and 5% aqueous sodium bicarbonate was added for separation. The chloroform layer was washed with 5% aqueous sodium sulfite and water and dried over anhydrous magnesium sulfate, and the solvent was distilled off under reduced pressure. Purification of the residue by silica gel column chromatography afforded 0.9 g of [3-(2,4-dichlorophenyl)phenyl] isopropyl sulfoxide (yield 85.0%) as a colorless dough (nD20 1.6169).

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US07767626B2uspto-grants-2010_08