Реакция #487555

ord-61be4968a74b463195197dfc717efde7

Уравнение реакции

CCc1ccc(-c2ccc(Cl)cc2)cc1[N+](=O)[O-]
4′-Chloro-4-ethyl-3-nitrobiphenyl
O
water
[Cl-].[NH4+]
ammonium chloride
CCc1ccc(-c2ccc(Cl)cc2)cc1N
3-amino-4′-chloro-4-ethylbiphenyl
Выход 75.3%

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    Температураthe mixture is heated
  2. 2
    Температураto reflux for 1 hour
  3. 3
    ТемператураThe reaction mixture is cooled to room temperature
  4. 4
    Фильтрацияfiltered through diatomaceous earth
  5. 5
    Другоеthe filtrate is evaporated in vacuo
  6. 6
    Другоеto remove most of the methanol
  7. 7
    ДругоеThe residue is partitioned between ethyl acetate (200 ml) and water
  8. 8
    Экстракцияthe aqueous phase is re-extracted with ethyl acetate (200 ml)
  9. 9
    Промывкаwashed with water and brine
  10. 10
    Сушкаdried over anhydrous magnesium sulfate
  11. 11
    Фильтрацияfiltered
  12. 12
    Другоеthe filtrate is evaporated in vacuo

Методика

4′-Chloro-4-ethyl-3-nitrobiphenyl (22.6 g, 0.086 mol) is suspended in methanol (250 ml) and the reaction mixture is stirred at room temperature. Distilled water (100 ml) is added, followed by zinc dust (39.0 g, 0.60 mol) and ammonium chloride (13.8 g, 0.26 mol) and the mixture is heated to reflux for 1 hour. The reaction mixture is cooled to room temperature, filtered through diatomaceous earth and the filtrate is evaporated in vacuo to remove most of the methanol. The residue is partitioned between ethyl acetate (200 ml) and water and the aqueous phase is re-extracted with ethyl acetate (200 ml). The organic extracts are combined, washed with water and brine, dried over anhydrous magnesium sulfate, filtered and the filtrate is evaporated in vacuo to give 3-amino-4′-chloro-4-ethylbiphenyl (15.0 g) as a colourless solid. The product is used directly without further purification in Step 5.

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US08741806B2uspto-grants-2014_06