Реакция #302873

ord-669cd56648894d7da16df5c19ad75e04

Уравнение реакции

C[NH2+]C.[I-]
N,N-dimethylammonium iodide
CC1(C)OC(=O)C(c2ccccc2)C(=O)O1
2,2-dimethyl-5-phenyl-[1,3]dioxane-4,6-dione
C=C(C(=O)OC)c1ccccc1
2-phenyl acrylic acid methyl ester
Выход 102.7%

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    workup.WAITto continue over night at 65° C
  2. 2
    Другоеthe solvent was removed under reduced pressure
  3. 3
    workup.ADDITIONThe residue was treated with diethyl ether
  4. 4
    Экстракцияextracted with a satured NaHCO3 solution and brine
  5. 5
    Сушкаdried over MgSO4
  6. 6
    ДругоеThe solvent was removed under reduced pressure

Методика

A solution of 25 g (135.1 mmol) N,N-dimethylammonium iodide and 11.91 g (54.1 mmol) 2,2-dimethyl-5-phenyl-[1,3]dioxane-4,6-dione in 585 ml abs. methanol was heated to 65° C. and the reaction was allowed to continue over night at 65° C. The reaction mixture was allowed to cool down to room temperature and the solvent was removed under reduced pressure. The residue was treated with diethyl ether, extracted with a satured NaHCO3 solution and brine and dried over MgSO4. The solvent was removed under reduced pressure and 9.01 g (quant.) of 2-phenyl acrylic acid methyl ester was isolated as a colourless oil. The compound was used without further purification.

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US08192918B2uspto-grants-2012_06