Реакция #2146692

ord-bed9b5606228417db00eddf1527df70f

Уравнение реакции

O=C(CBr)c1ccc(OC(=O)c2ccccc2)cc1
4′-benzoyloxy-2-bromoacetophenone
COc1ccc(N)nc1
2-amino-5-methoxypyridine
O=C([O-])O.[Na+]
sodium hydrogencarbonate
COc1ccc2nc(-c3ccc(OC(=O)c4ccccc4)cc3)cn2c1
2-(4′-benzoyloxyphenyl)-6-methoxyimidazo[1,2-a]pyridine
Выход 70.7%

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    ТемператураThe resulting solution was refluxed for 2 hours
  2. 2
    ТемператураAfter the reaction solution was cooled
  3. 3
    ДругоеThe resulting reaction mixture
  4. 4
    Температураwas further refluxed for 4 hours
  5. 5
    ДругоеAfter the completion of the reaction
  6. 6
    Концентрированиеthe solvent was concentrated under reduced pressure
  7. 7
    workup.DISSOLUTIONThe resulting residue was dissolved in chloroform
  8. 8
    Промывкаwashed with water
  9. 9
    СушкаAfter the chloroform layer was dried over anhydrous sodium sulfate
  10. 10
    workup.DISTILLATIONthe solvent was distilled off
  11. 11
    ДругоеThe resulting crude product was purified by silica gel column chromatography (elution solvent: chloroform/ethyl acetate=20/1)

Методика

13.33 g (corresponding to 43.68 mmol) of 4′-benzoyloxy-2-bromoacetophenone and 5.67 g (corresponding to 45.67 mmol) of 2-amino-5-methoxypyridine were dissolved in 481 mL of ethanol. The resulting solution was refluxed for 2 hours. After the reaction solution was cooled, 6.64 g (corresponding to 79.09 mmol) of sodium hydrogencarbonate was added thereto. The resulting reaction mixture was further refluxed for 4 hours. After the completion of the reaction, the solvent was concentrated under reduced pressure. The resulting residue was dissolved in chloroform and then washed with water. After the chloroform layer was dried over anhydrous sodium sulfate, the solvent was distilled off. The resulting crude product was purified by silica gel column chromatography (elution solvent: chloroform/ethyl acetate=20/1) to obtain 10.20 g (corresponding to 30.87 mmol) of 2-(4′-benzoyloxyphenyl)-6-methoxyimidazo[1,2-a]pyridine (FIG. 3, Step 5).

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US08277777B2uspto-grants-2012_10