Реакция #1857550

ord-c33200089daf434cb1aba83d99804c0a

Уравнение реакции

COC(=O)[C@@H](CCC(C)C)[C@H](C)O
(S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhexanoate
CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2
((1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid
COc1ccc(COC(=N)C(Cl)(Cl)Cl)cc1
4-methoxybenzyl 2,2,2-trichloroacetimidate
COC(=O)[C@@H](CCC(C)C)[C@H](C)OCc1ccc(OC)cc1
title compound
Выход 77.0%
COC(=O)[C@@H](CCC(C)C)[C@H](C)OCc1ccc(OC)cc1
(S)-methyl 2-((S)-1-((4-methoxybenzyl)oxy)ethyl)-5-methylhexanoate
Выход 77.0%

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    ДругоеThe reaction mixture was removed from the cold bath
  2. 2
    workup.ADDITIONHexane (50 mL) was added to the reaction
  3. 3
    Другоеthe precipitate was removed by filtration
  4. 4
    ПромывкаThe solids were washed with hexanes (2×10 mL), Celite® (2 scoopula tip-fulls)
  5. 5
    workup.ADDITIONwas added to the combined filtrate and washes
  6. 6
    Другоеthe solvent was removed under reduced pressure
  7. 7
    Другоеpurified

Методика

To a solution of (S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhexanoate (5.00 g, 26.6 mmol) and ((1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid (camphorsulfonic acid, CSA; 0.617 g, 2.66 mmol) in DCM (53.1 mL) was added 4-methoxybenzyl 2,2,2-trichloroacetimidate (8.27 mL, 39.8 mmol) at 0° C. The reaction mixture was removed from the cold bath and stirred at room temperature for 17 h. Hexane (50 mL) was added to the reaction and the precipitate was removed by filtration. The solids were washed with hexanes (2×10 mL), Celite® (2 scoopula tip-fulls) was added to the combined filtrate and washes, and the solvent was removed under reduced pressure. The resulting adsorbed material was directly loaded onto a column and purified using flash column chromatography (80 g SiO2, 0→35% EtOAc/hexanes) to afford the title compound (6.3 g, 20.4 mmol, 77%) as a colorless oil; 1H NMR (400 MHz, CDCl3) δ 7.24-7.16 (m, 2H), 6.89-6.79 (m, 2H), 4.49 (d, J=11.2 Hz, 1H), 4.33 (d, J=11.1 Hz, 1H), 3.75 (s, 3H), 3.74-3.62 (m, 4H), 2.49 (ddd, J=10.7, 8.2, 4.0 Hz, 1H), 1.62-1.40 (m, 3H), 1.23-1.16 (m, 3H), 1.16-1.03 (m, 2H), 0.87 (d, J=3.9 Hz, 3H), 0.85 (d, J=3.9 Hz, 3H); 13C NMR (101 MHz, CDCl3) δ 175.03, 159.10, 130.63, 129.14, 113.62, 76.16, 70.71, 55.11, 52.64, 51.25, 36.58, 27.97, 26.00, 22.69, 22.17, 17.08; ESIMS m/z 331 ([M+Na]+).

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US09247741B2uspto-grants-2016_02