Реакция #155342

ord-83d88a159ba840e4a5053a27fac742ed

Уравнение реакции

CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CCSCCC(=O)O)c12
3-{2-[5-Fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxy-4H-quinolin-1-yl]ethylsulfanyl}propionic acid
O=C(OO)c1cccc(Cl)c1
m-chloroperbenzoic acid
O=S([O-])O.[Na+]
sodium hydrogen sulfite
CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CCS(=O)(=O)CCC(=O)O)c12
3-{2-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxy-4H-quinolin-1-yl]ethanesulfonyl}propionic acid
Выход 91.0%

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    workup.ADDITIONwas added
  2. 2
    ДругоеThe resulting reaction mixture
  3. 3
    Температураcooled
  4. 4
    Экстракцияfollowed by extraction with dichloromethane
  5. 5
    ПромывкаThe thus-obtained organic layer was washed with water
  6. 6
    Концентрированиеconcentrated under reduced pressure
  7. 7
    ДругоеThe residue was purified
  8. 8
    КонцентрированиеThe purified product was concentrated under reduced pressure
  9. 9
    Другоеsubjected to recrystallization from ethyl acetate-n-hexane

Методика

3-{2-[5-Fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxy-4H-quinolin-1-yl]ethylsulfanyl}propionic acid (2.26 g, 4.92 mmol) was dissolved in a mixed solvent of dichloromethane (100 ml) and methanol (20 ml), m-chloroperbenzoic acid (mCPBA, purity: 70%, 2.55 g, 10.33 mmol) was added thereto, and the mixture was then stirred at room temperature for 1 hour. The resulting reaction mixture was ice-cooled. An aqueous saturated sodium hydrogen sulfite solution (50 ml) was added to the reaction mixture, followed by extraction with dichloromethane. The thus-obtained organic layer was washed with water and then concentrated under reduced pressure. The residue was purified using silica gel column chromatography (dichloromethane:methanol=100:0→100:10). The purified product was concentrated under reduced pressure and subjected to recrystallization from ethyl acetate-n-hexane, giving a pale yellow powder of 3-{2-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxy-4H-quinolin-1-yl]ethanesulfonyl}propionic acid (2.2 g, yield: 91%).

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: USRE045108E1uspto-grants-2014_09