Реакция #1552056

ord-f425b498168f4341b45de38d74c006ef

Уравнение реакции

C=CCOc1ccc([N+](=O)[O-])c(CO)c1
5-allyloxy-2-nitrobenzyl alcohol
O=C(OO)c1cccc(Cl)c1
m-chloroperoxybenzoic acid
O=[N+]([O-])c1ccc(OCC2CO2)cc1CO
5-glycidyloxy-2-nitrobenzyl alcohol

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    Другоеpeaks disappeared from the 1H-NMR spectrum (approximately 48 hours)
  2. 2
    ПромывкаThe reaction was then washed with aqueous sodium carbonate twice
  3. 3
    Сушкаwater three times and then dried over sodium sulfate
  4. 4
    ДругоеThe solvent was partially removed by rotary evaporation
  5. 5
    workup.ADDITIONpoured into hexanes
  6. 6
    Другоеto precipitate the product
  7. 7
    ФильтрацияThe resulting solid was collected by suction filtration
  8. 8
    Другоеwas used in the next step without further purification

Методика

5-allyloxy-2-nitrobenzyl alcohol (7.3 g, 35 mmol) and m-chloroperoxybenzoic acid (77 wt. %, 9.4 g, 42 mmol) were dissolved in dichloromethane and refluxed until the allyl peaks disappeared from the 1H-NMR spectrum (approximately 48 hours). The reaction was then washed with aqueous sodium carbonate twice, water three times and then dried over sodium sulfate. The solvent was partially removed by rotary evaporation and then poured into hexanes to precipitate the product. The resulting solid was collected by suction filtration and was used in the next step without further purification.

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US08999623B2uspto-grants-2015_04