Реакция #1328402

ord-94a152ad47834b769041e85313c6e34f

Уравнение реакции

CC[C@@H](C[C@H](O)[C@@H](C)N(Cc1ccccc1)Cc1ccccc1)c1ccccc1
N,N-dibenzyl-(1R,2S,4S)-1-methyl-2-hydroxy-4-phenylhexyl amine
CC(=O)O
acetic acid
CC[C@@H](C[C@H](O)[C@@H](C)N)c1ccccc1
(1R,2S,4S)-1-methyl-2-hydroxy-4-phenylhexyl amine
Выход 78.5%

Растворители

Условия реакции

Температура
50°CELSIUS
Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    Фильтрацияthe catalyst was filtered off
  2. 2
    ДругоеThe liquid filtrate thus obtained
  3. 3
    Концентрированиеwas concentrated under reduced pressure
  4. 4
    workup.ADDITIONTo the resulting residue, a saturated sodium hydrogen carbonate aqueous solution (15 ml) was added
  5. 5
    Экстракцияtwo 50 ml methylene chloride extractions
  6. 6
    СушкаThe resulting organic layer was dried with anhydrous magnesium sulfate
  7. 7
    ФильтрацияMagnesium sulfate was filtered off
  8. 8
    Концентрированиеthe liquid filtrate was concentrated under reduced pressure

Методика

The N,N-dibenzyl-(1R,2S,4S)-1-methyl-2-hydroxy-4-phenylhexyl amine (1.46 g, 3.77 mmol) obtained above was dissolved in methanol (25 ml). Subsequently, acetic acid (0.43 ml, 7.53 mmol) and 5% Pd-C (palladium carbon; containing 50% of water) (0.6 g) were added to the dissolved solution. This reaction solution was stirred for 16 hours at 50° C. under a hydrogen atmosphere, and the catalyst was filtered off. The liquid filtrate thus obtained was concentrated under reduced pressure. To the resulting residue, a saturated sodium hydrogen carbonate aqueous solution (15 ml) was added and two 50 ml methylene chloride extractions were performed. The resulting organic layer was dried with anhydrous magnesium sulfate. Magnesium sulfate was filtered off and the liquid filtrate was concentrated under reduced pressure to yield (1R,2S,4S)-1-methyl-2-hydroxy-4-phenylhexyl amine (0.61 g, 2.96 mmol).

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US07115296B2uspto-grants-2006_10