Реакция #1121717

ord-6443f120eee842b89ebc7183e3ed6996

Уравнение реакции

[Cl-].[NH4+]
ammonium chloride
O=S(Cl)Cl
thionyl chloride
C=CC(=O)OCCCCCCOc1ccc(C(=O)O)cc1
4-{[6-(acryloyloxy)hexyl]oxy}benzoic acid
Oc1ccc(OCCCCCCBr)cc1
4-(6-bromohexyloxy)phenol
C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCCBr)cc2)cc1
4-(6-bromo hexyloxy)phenyl 4-{[6-(acryloyloxy)hexyl]oxy}benzoate
Выход 59.9%

Растворители

Условия реакции

Подробные условия
See reaction.notes.procedure_details.

Обработка

  1. 1
    Другоеwas adjusted to a temperature of 0° C. (Celsius)
  2. 2
    workup.STIRRINGstirred at 0° C. (Celsius) for 1 hour
  3. 3
    workup.STIRRINGstirred at a room temperature overnight
  4. 4
    ДругоеThe resulting reaction mixture
  5. 5
    Экстракцияwas extracted three times with ethyl acetate (50 ml (milliliters)), and waster
  6. 6
    Другоеwas removed over magnesium sulfate
  7. 7
    ДругоеThen, the solvents were evaporated
  8. 8
    Другоеthe resulting reaction mixture
  9. 9
    Другоеwas then purified

Методика

4-{[6-(acryloyloxy)hexyl]oxy}benzoic acid (4) (2.8 g (grams)) was dissolved in tetrahydrofurane (THF, 100 ml (milliliters)) at a room temperature, and a temperature of the resulting mixture was adjusted to a temperature of 0° C. (Celsius). Then, thionyl chloride (12 ml (milliliters), 1M in THF) was added to the mixture, and stirred for 30 minutes. Then, 4-(6-bromohexyloxy)phenol (2.5 g (grams)) and triethyl amine (13 ml (milliliters)) were added to the resulting reaction mixture, stirred at 0° C. (Celsius) for 1 hour, and then stirred at a room temperature overnight. Next day, a saturated ammonium chloride aqueous solution was poured into the reaction mixture, and the reaction was completed. The resulting reaction mixture was extracted three times with ethyl acetate (50 ml (milliliters)), and waster was removed over magnesium sulfate. Then, the solvents were evaporated, and the resulting reaction mixture was then purified using a column chromatography (developer solution: ethylacetate/hexane=1/2 volume ratio) to obtain 4-(6-bromo hexyloxy)phenyl 4-{[6-(acryloyloxy)hexyl]oxy}benzoate (5) (3 g (grams)).

Источник

DOI: 10.6084/m9.figshare.5104873.v1Патент: US08545717B2uspto-grants-2013_10