반응 #9987

ord-3b056c8ed15b41ed951feb84fb0fb850

반응 방정식

CC(C)(C)[O-].[K+]
Potassium t-butoxide
COC(=O)[C@@H]1CC(=O)CN1C(=O)OCc1ccccc1
(S)-1-benzyloxycarbonyl-4-oxoproline methyl ester
[Cl-].[NH4+]
ammonium chloride
C=C1C[C@@H](C(=O)OC)N(C(=O)OCc2ccccc2)C1
title compound
수율 72.6%
C=C1C[C@@H](C(=O)OC)N(C(=O)OCc2ccccc2)C1
(S)-1-Benzyloxycarbonyl-4-methylideneproline methyl ester
수율 72.6%

반응 조건

온도
5°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.STIRRINGthe resulting mixture was stirred at 35° C. for 3 hours
  2. 2
    기타partitioned
  3. 3
    세척The organic layer was washed with water
  4. 4
    건조dried over anhydrous magnesium sulfate
  5. 5
    기타the solvent was removed by distillation under reduced pressure
  6. 6
    기타The residue was purified by column chromatography through silica gel (eluent, ethyl acetate:hexane=1:3)

실험 절차

Potassium t-butoxide (1.41 g, 12.6 mmol) was suspended in diethyl ether (100 ml). To the suspension was added methyltriphenylphosphonium bromide (4.80 g, 13.4 mmol), and the resulting mixture was stirred at 5° C. for 15 minutes. To the mixture was added (S)-1-benzyloxycarbonyl-4-oxoproline methyl ester (2.50 g, 9.0 mmol) in diethyl ether (30 ml), and the resulting mixture was stirred at 35° C. for 3 hours. At the end of this time, the reaction mixture was added to a saturated solution of ammonium chloride (50 ml) under ice cooling, and then partitioned. The organic layer was washed with water, dried over anhydrous magnesium sulfate and the solvent was removed by distillation under reduced pressure. The residue was purified by column chromatography through silica gel (eluent, ethyl acetate:hexane=1:3), to give the title compound (1.80 g) as a pale yellow oil (yield 72%).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07091352B2uspto-grants-2006_08