반응 #997818

ord-86a411f2ad02488a8c40f3eeb5b44cc1

반응 방정식

O=S(=O)(O)O
sulfuric acid
O=[N+]([O-])O
nitric acid
COc1cccnc1Br
2-bromo-3-methoxypyridine
COc1ccc([N+](=O)[O-])nc1Br
2-bromo-3-methoxy-6-nitropyridine

반응 조건

온도
55°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.STIRRINGthe mixture was stirred at room temperature for 10 minutes
  2. 2
    workup.STIRRINGfurther stirred for an hour
  3. 3
    온도After the reaction solution was cooled to room temperature
  4. 4
    workup.ADDITIONthe reaction solution was poured little by little
  5. 5
    기타into crushed ice
  6. 6
    기타to generate precipitates
  7. 7
    여과The precipitates were filtered
  8. 8
    세척washed with water
  9. 9
    건조dried over phosphorous pentoxide under reduced pressure

실험 절차

83 mL of conc. sulfuric acid was cooled down to −5° C., and 83 mL of 90% nitric acid was carefully added thereto. Subsequently, 20.69 g (corresponding to 110.04 mmol) of 2-bromo-3-methoxypyridine was carefully added thereto. After the reaction mixture was stirred in an ice bath for 5 minutes, the mixture was stirred at room temperature for 10 minutes, and then was heated to 55° C. and further stirred for an hour. After the reaction solution was cooled to room temperature, the reaction solution was poured little by little into crushed ice to generate precipitates. The precipitates were filtered and washed with water, and then dried over phosphorous pentoxide under reduced pressure, to obtain 17.41 g (corresponding to 74.71 mmol) of 2-bromo-3-methoxy-6-nitropyridine (FIG. 5, Step 2).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08022207B2uspto-grants-2011_09