반응 #9870

ord-c113ed0e9c5f49ae997f36f353ec3220

반응 방정식

NCCc1ccc(S(N)(=O)=O)cc1
4-(2-Aminoethyl)benzene sulfonamide
O=Cc1cccc(-c2cccc(C(=O)NCCN3CCCC3)c2)c1
3′-formyl-N-[2-(1-pyrrolidinyl)ethyl][1,1′-biphenyl]-3-carboxamide
NS(=O)(=O)c1ccc(CCNCc2cccc(-c3cccc(C(=O)NCCN4CCCC4)c3)c2)cc1
3′-[{2-[4-(Aminosulfonyl)phenyl]ethyl}aminomethyl]-N-[2-(1-pyrrolidinyl)ethyl]-[1,1′-biphenyl]-3-carboxamide

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    여과the molecular sieves were filtered off
  2. 2
    농축the filtrate was concentrated under reduced pressure
  3. 3
    workup.DISSOLUTIONThe residues were dissolved in a mixed solvent (100 ml) of methanol-THF (1:1), and sodium borohydride (0.89 g)
  4. 4
    workup.ADDITIONwas added
  5. 5
    workup.STIRRINGThe reaction mixture was stirred at room temperature for 5 hours
  6. 6
    기타the solvent was evaporated under reduced pressure
  7. 7
    workup.ADDITIONThe residues were diluted with water
  8. 8
    추출extracted with ethyl acetate
  9. 9
    세척The extract was washed with brine
  10. 10
    건조dried over anhydrous magnesium sulfate
  11. 11
    기타the solvent was evaporated under reduced pressure
  12. 12
    기타The residues were crystallized from hexane, whereby the title compound (3.71 g)
  13. 13
    기타was obtained

실험 절차

4-(2-Aminoethyl)benzene sulfonamide (2.37 g) and molecular sieves 3A (4.0 g) were added to a solution of 3′-formyl-N-[2-(1-pyrrolidinyl)ethyl][1,1′-biphenyl]-3-carboxamide (3.81 g) in methanol (50 ml), and the mixture was stirred at room temperature for 1.5 hours. After the reaction mixture was diluted with tetrahydrofuran (THF), the molecular sieves were filtered off, and the filtrate was concentrated under reduced pressure. The residues were dissolved in a mixed solvent (100 ml) of methanol-THF (1:1), and sodium borohydride (0.89 g) was added thereto. The reaction mixture was stirred at room temperature for 5 hours, and then the solvent was evaporated under reduced pressure. The residues were diluted with water and extracted with ethyl acetate. The extract was washed with brine and then dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure. The residues were crystallized from hexane, whereby the title compound (3.71 g) was obtained.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07091247B2uspto-grants-2006_08