반응 #84296

ord-d0c9b7946e174fe78f9564fb0b5e5355

반응 방정식

O
water
CC(C)(C)OC(=O)NCC(=NO)c1ncc(Cl)cc1Cl
tert-butyl N-[2-(3,5-dichloropyridin-2-yl)-2-(hydroxyimino)ethyl]carbamate
O=C([O-])[O-].[K+].[K+]
potassium carbonate
O=S(=O)(OCC(F)(F)F)C(F)(F)F
2,2,2-trifluoroethyl trifluoromethanesulfonate
CC(C)(C)OC(=O)NCC(=NOCC(F)(F)F)c1ncc(Cl)cc1Cl
desired product
수율 76.4%
CC(C)(C)OC(=O)NCC(=NOCC(F)(F)F)c1ncc(Cl)cc1Cl
tert-butyl N-[2-(3,5-dichloropyridin-2-yl)-2-(2,2,2-trifluoroethoxyimino)ethyl]carbamate
수율 76.4%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타After completion of the reaction
  2. 2
    추출extracted with ethyl acetate (100 ml×2)
  3. 3
    세척washed with water (50 ml×2)
  4. 4
    건조dried over saturated aqueous sodium chloride
  5. 5
    기타anhydrous sodium sulfate, and the solvent was evaporated under reduced pressure
  6. 6
    기타The resulting residue was purified by silica gel column chromatography

실험 절차

To 5.0 g of tert-butyl N-[2-(3,5-dichloropyridin-2-yl)-2-(hydroxyimino)ethyl]carbamate in 16.0 ml of N,N-dimethylformamide, 4.3 g of potassium carbonate and 5.4 g of 2,2,2-trifluoroethyl trifluoromethanesulfonate were added, and the mixture was stirred at room temperature for 18 hours. After completion of the reaction, the reaction mixture was mixed with 100 ml of water and extracted with ethyl acetate (100 ml×2), the resulting organic layers were combined, washed with water (50 ml×2) and dried over saturated aqueous sodium chloride and then anhydrous sodium sulfate, and the solvent was evaporated under reduced pressure. The resulting residue was purified by silica gel column chromatography using ethyl acetate-hexane (with a gradient of from 0:10 to 3:7) as the eluent to obtain 4.8 g of the desired product as a pale yellow oil.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US09434684B2uspto-grants-2016_09