반응 #84027

ord-aac163278d774f779aaceb5fc6c049d3

반응 방정식

[H][H]
Hydrogen
[H][H]
Hydrogen
O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O
3-nitrophthalic acid
[H][H]
hydrogen
Nc1cccc(C(=O)O)c1C(=O)O
3-aminophthalic acid
수율 84.0%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타the mixture was purged with nitrogen 3 times
  2. 2
    여과The suspension was filtered through a celite bed
  3. 3
    세척rinsed with methanol
  4. 4
    농축The filtrate was concentrated in vacuo
  5. 5
    기타isolated by vacuum filtration
  6. 6
    기타The solid was dried in vacuo to a constant weight

실험 절차

10% Pd/C (2.5 g), 3-nitrophthalic acid (75.0 g, 355 mmol) and ethanol (1.5 L) were charged to a 2.5 L Parr hydrogenator under a nitrogen atmosphere. Hydrogen was charged to the reaction vessel for up to 55 psi. The mixture was shaken for 13 hours, maintaining hydrogen pressure between 50 and 55 psi. Hydrogen was released and the mixture was purged with nitrogen 3 times. The suspension was filtered through a celite bed and rinsed with methanol. The filtrate was concentrated in vacuo. The resulting solid was reslurried in ether and isolated by vacuum filtration. The solid was dried in vacuo to a constant weight, affording 54 g (84% yield) of 3-aminophthalic acid as a yellow product. 1H-NMR (DMSO-d6) δ: 3.17 (s, 2H), 6.67 (d, 1H), 6.82 (d, 1H), 7.17 (t, 1H), 8-10 (br, s, 2H); 13C-NMR (DMSO-d6) δ: 112.00, 115.32, 118.20, 131.28, 135.86, 148.82, 169.15, 170.09.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US09433606B2uspto-grants-2016_09