반응 #83842

ord-33364614b12d4de5a33eb745d4ae3605

반응 방정식

Cc1ccc(C)c(C(O)C(=O)O)c1
2.5-dimethylmandelic acid
CCOC(=O)C(=O)C(=O)[O-]
ethyl oxomalonate
Cc1ccc(C)cc1
para-xylene
Cc1ccc(C)cc1
para-xylene
CCOC(=O)C(O)(C(=O)OCC)c1cc(C)ccc1C
diethyl (2,5-dimethylphenyl)-hydroxymalonate

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONwas charged over 20 minutes
  2. 2
    기타the mixture was quenched on a mixture of ice and 10M hydrochloric acid
  3. 3
    추출extracted into diethyl ether
  4. 4
    세척The separated organic phase was washed with water
  5. 5
    건조dried over magnesium sulfate
  6. 6
    여과filtered
  7. 7
    기타the solvent was evaporated under reduced pressure
  8. 8
    workup.DISTILLATIONThe crude brown oil (31 parts) was then distilled under vacuum

실험 절차

The method used to prepare 2.5-dimethylmandelic acid was similar to that described by Riebsomer and Irvine (Org.Synth.,Coll.Vol.3, p.327). Thus, ethyl oxomalonate (25 parts) in para-xylene (38 parts) was stirred at 0°-5° C. under a nitrogen atmosphere as anhydrous stannic chloride (46 parts) was charged over 20 minutes. The mixture was kept mobile by addition of further para-xylene (43 parts) and allowed to warm to ambient temperature. After 3 hours stirring, the mixture was quenched on a mixture of ice and 10M hydrochloric acid and extracted into diethyl ether. The separated organic phase was washed with water, dried over magnesium sulfate, filtered and the solvent was evaporated under reduced pressure. The crude brown oil (31 parts) was then distilled under vacuum to give diethyl (2,5-dimethylphenyl)-hydroxymalonate (26 parts). 1Hnmr, 13Cnmr and mass spectra and micro-analysis were all consistent with the structure.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05625080uspto-grants-1997_04