반응 #835923

ord-0aa33bd0bec845c78a9fdb2d13883f13

반응 방정식

[Cl-].[NH4+]
ammonium chloride
C[CH](C)[Mg][Cl]
isopropylmagnesium chloride
COc1cccnc1Br
2-bromo-3-methoxypyridine
O=Cc1cc(F)ccc1F
2,5-difluorobenzaldehyde
COc1cccnc1C(O)c1cc(F)ccc1F
2-[(2,5-Difluorophenyl)-hydroxymethyl]-3-methoxypyridine

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도The temperature of the reaction mixture was raised gradually to room temperature
  2. 2
    추출followed by extraction with ethyl acetate
  3. 3
    기타The solvent was dried
  4. 4
    농축followed by concentration under reduced pressure
  5. 5
    기타to yield needle crystals
  6. 6
    기타The resulting needle crystals were triturated with hexane, whereby the title compound (660 mg, 88%)
  7. 7
    기타was obtained

실험 절차

Under an argon atmosphere, a tetrahydrofuran solution (1.5 ml, 3 mmol) of isopropylmagnesium chloride was added dropwise to a tetrahydrofuran (2 ml) solution of 2-bromo-3-methoxypyridine (564 mg, 3 mmol) under ice cooling. The resulting mixture was stirred at room temperature for 60 minutes. Under ice cooling, 2,5-difluorobenzaldehyde (328 μl, 3 mmol) was added dropwise to the resulting brown solution. The temperature of the reaction mixture was raised gradually to room temperature. To the reaction mixture was added a saturated aqueous solution of ammonium chloride, followed by extraction with ethyl acetate. The solvent was dried, followed by concentration under reduced pressure to yield needle crystals. The resulting needle crystals were triturated with hexane, whereby the title compound (660 mg, 88%) was obtained.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07399775B2uspto-grants-2008_07