반응 #82996

ord-06bde4604c634d9585ef9b579d76369b

반응 방정식

CCCCCCCCBr
octyl bromide
O=c1c2ccc(O)cc2oc2cc(O)ccc12
3,6-Dihydroxy xanthone
O
water
CCCCCCCCOc1ccc2c(=O)c3ccc(O)cc3oc2c1
3-Octoxy-6-hydroxy xanthone
수율 30.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.DISSOLUTIONAfter the compound was completely dissolved
  2. 2
    온도at refluxing temperature
  3. 3
    기타giving a precipitate
  4. 4
    여과This white precipitate was then filtered
  5. 5
    세척washed with water
  6. 6
    세척washed with hot hexane
  7. 7
    기타to remove the disubstituted side product

실험 절차

3,6-Dihydroxy xanthone (1,20 mmol) was dissolved in hot mixture of basic water (80 mmol of Na2CO3 in 100 ml of water) and 50 ml of methanol. After the compound was completely dissolved, a methanol solution of octyl bromide (40 mmol in 50 ml of methanol) was added dropwise and the reaction mixture was stirred rigorously for 120 hours at refluxing temperature. The reaction mixture was cooled to room temperature giving a precipitate. This white precipitate was then filtered, washed with water, and washed with hot hexane to remove the disubstituted side product. 3-Octoxy-6-hydroxy xanthone was obtained in 30% yield. 1HNMR (DMSO): d11.0(1H,s), 8.05 (1H,d,J=6.0 Hz), 8.02 (1H,d,J=5.8 Hz), 7.08 (1H,s), 7.00 (1H,d,J=8.8 Hz), 6.89 (1H,d,J=8.8 Hz), 6.85 (1H,s), 4.43 (2H,t,J=6.2 Hz), 1.8(2H,M), 1.3 (10H,m), 0.9 (3H,t).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05623080uspto-grants-1997_04