반응 #828716

ord-af01db63257f4f64b801d1c480a2a5e2

반응 방정식

O=C1OC(=O)c2c(O)cccc21
3-Hydroxyphthalic anhydride
NN
Hydrazine
O=c1[nH][nH]c(=O)c2c(O)cccc12
5-Hydroxy-2,3-dihydrophthalazine-1,4-dione

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.WAITAfter a few minutes
  2. 2
    기타a white precipitate formed
  3. 3
    여과filtered
  4. 4
    세척The solids were washed with 150 mL of water
  5. 5
    기타to dry in the air

실험 절차

3-Hydroxyphthalic anhydride (2.0 g, 12.2 mmol, Aldrich) was stirred with 25 mL of glacial acetic acid until nearly all dissolved. Hydrazine (8.4 mL, 268 mmol) was added dropwise to the mixture. The reaction mixture fumed and became homogeneous with development of a yellow color. After a few minutes, a white precipitate formed and the yellow color faded. The mixture was stirred for three days and then filtered. The solids were washed with 150 mL of water followed by 125 mL of acetonitrile and allowed to dry in the air and then under vacuum. Yield: 2.06 g (95%). 1H NMR (DMSO-d6): δ 12.83 (s, 1H), 12.06 (s, 1H), 11.68 (s, 1H), 7.76-7.70 (t, 1H), 7.34-7.31 (d, 1H), 7.14-7.12 (d, 1H); 13C NMR (DMSO-d6): δ 163.04, 160.68, 152.74, 136.37, 126.38, 118.34, 114.50, 113.76; MS: (m/e) 178 (M+), 148, 120, 92.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05552298uspto-grants-1996_09