반응 #80274

ord-265411a67d4e43cd99880870f303237a

반응 방정식

CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)O)c12
5-(4,6-dimethoxypyrimidin-2-yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylic acid
CC(C)(C)C(=O)OCCl
chloromethyl pivalate
O=C([O-])[O-].[K+].[K+]
potassium carbonate
CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)OCOC(=O)C(C)(C)C)c12
desired compound
수율 84.0%
CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)OCOC(=O)C(C)(C)C)c12
Pivaloyloxymethyl 5-(4,6-Dimethoxypyrimidin-2-yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylate
수율 84.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    추출extracted with ethyl acetate
  2. 2
    세척The organic layer was washed with water
  3. 3
    건조dried over anhydrous sodium sulfate
  4. 4
    농축It was concentrated under reduced pressure
  5. 5
    기타the oily substance thereby obtained
  6. 6
    기타was purified by silica gel column chromatography (n-hexane/ethyl acetate=4/1)

실험 절차

A mixture comprising 0.40 g of 5-(4,6-dimethoxypyrimidin-2-yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylic acid, 0.26 g of chloromethyl pivalate and 0.21 g of potassium carbonate in 20 ml of N,N-dimethylformamide, was stirred at room temperature for 6 hours, then poured into ice water and extracted with ethyl acetate. The organic layer was washed with water and then dried over anhydrous sodium sulfate. It was concentrated under reduced pressure, and the oily substance thereby obtained was purified by silica gel column chromatography (n-hexane/ethyl acetate=4/1) to obtain 0.43 g (yield: 84%) of the desired compound.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05616537uspto-grants-1997_04