반응 #80273

ord-d6d339541bde41239f4dbc25a36315a6

반응 방정식

CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)OCc3ccccc3)c12
benzyl 5-(4,6-dimethoxypyrimidin-2-yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylate
CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)O)c12
desired compound
수율 89.0%
CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)O)c12
5-(4,6-Dimethoxypyrimidin-2yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylic Acid
수율 89.0%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타After completion of the reaction
  2. 2
    기타an insoluble matter was separated by filtration
  3. 3
    농축the filtrate was concentrated under reduced pressure, whereupon the precipitated crystals
  4. 4
    세척were washed with a solvent mixture of diethyl ether/n-hexane

실험 절차

A mixture comprising 14.4 g of benzyl 5-(4,6-dimethoxypyrimidin-2-yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylate and 4.52 g of 10% palladium carbon in 100 ml of ethanol, was subjected to hydrogenation under an ordinary pressure while stirring at room temperature. After completion of the reaction, an insoluble matter was separated by filtration, and the filtrate was concentrated under reduced pressure, whereupon the precipitated crystals were washed with a solvent mixture of diethyl ether/n-hexane to obtain 10.47 g (yield: 89%) of the desired compound.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05616537uspto-grants-1997_04