반응 #78488

ord-cf227f6cec7c463bb792819576676850

반응 방정식

CCOC(=O)CCN(C(=O)c1ccc2sc(CNc3ccc(C#N)cc3)nc2c1)c1ccccc1
2-[N-(4-cyanophenyl)aminomethyl]benzothiazole-5-carboxylic acid-N-phenyl-N-(2-ethoxycarbonylethyl)amide
Cl
hydrogen chloride
CCO.ClCCl
dichloromethane ethanol
O=C([O-])[O-].[NH4+].[NH4+]
ammonium carbonate
CCOC(=O)CCN(C(=O)c1ccc2sc(CNc3ccc(C(=N)N)cc3)nc2c1)c1ccccc1
2-[N-(4-amidinophenyl)aminomethyl]benzothiazole-5-carboxylic acid-N-phenyl-N-(2-ethoxycarbonylethyl)amide

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타at room temperature
  2. 2
    workup.DISTILLATIONThen the solvent was distilled off at a maximum bath temperature of 30° C.
  3. 3
    workup.DISTILLATIONthe solvent was distilled off in vacuo
  4. 4
    기타the crude product was purified by flash chromatography (silica gel; gradient: water/methanol=19:1 to 4:1)
  5. 5
    기타When the eluates are evaporated down the desired compound
  6. 6
    기타is obtained as a white foam

실험 절차

1.1 g (2.27 mmol) of 2-[N-(4-cyanophenyl)aminomethyl]benzothiazole-5-carboxylic acid-N-phenyl-N-(2-ethoxycarbonylethyl)amide was stirred in 100 mL of ethanol saturated with hydrogen chloride for 5 hours, first at 0° C. and then at room temperature, until no more starting material could be detected by thin layer chromatography. Then the solvent was distilled off at a maximum bath temperature of 30° C. and the oily residue was taken up in 100 mL of absolute ethanol and mixed with 1.6 g (22 mmol) of ammonium carbonate. After 18 hours stirring at room temperature, the solvent was distilled off in vacuo and the crude product was purified by flash chromatography (silica gel; gradient: water/methanol=19:1 to 4:1). When the eluates are evaporated down the desired compound is obtained as a white foam. Yield: 0.77 g (63% of theory), C27H27N5O3S (501.60); Rf value: 0.19 (silica gel; dichloromethane/ethanol=3:7); mass spectrum: (M+H)+=502.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06710055B2uspto-grants-2004_03