반응 #7306

ord-aa9d08d4a8be45e7b7b7d7d151edf62c

반응 방정식

COC(=O)N[C@@H]1CNCC[C@@H]1C
cis-(4-methyl-piperidin-3-yl)-carbamic acid methyl ester
O=Cc1ccccc1
benzaldehyde
CC(=O)O[BH-](OC(C)=O)OC(C)=O.[Na+]
sodium triacetoxyborohydride
COC(=O)N[C@@H]1CN(Cc2ccccc2)CC[C@@H]1C
Cis-(1-Benzyl-4-methyl-piperidin-3-yl)-carbamic acid methyl ester
수율 70.0%

반응 조건

온도
20°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타to exotherm to 30°-35° C
  2. 2
    기타The reaction was quenched with 78 ml saturated sodium bicarbonate (20 volumes)
  3. 3
    추출extracted into 78 ml methylene chloride (20 volumes)
  4. 4
    농축concentrated to a clear oil

실험 절차

The reductive amination of cis-(4-methyl-piperidin-3-yl)-carbamic acid methyl ester was carried out by charging 3.9 grams (1 equiv., 22.6 mmol) to 2.07 ml benzaldehyde (0.9 equiv., 20.4 mmol), 9.6 grams sodium triacetoxyborohydride (2 equivs., 45.3 mmol) and 39 ml methylene chloride (10 volumes). The reaction was stirred at 20° C. and was allowed to exotherm to 30°-35° C. The reaction was complete by GCMS within 30 minutes. The reaction was quenched with 78 ml saturated sodium bicarbonate (20 volumes), extracted into 78 ml methylene chloride (20 volumes) and concentrated to a clear oil. (70% yield). 1H NMR: δ7.2-7.3 (5 H, m, aromatic protons), 5.50-5.48 (1 H, d, J=8.8 Hz), 3.77-3.75 (1 H, d, J=8.0 Hz), 3.63 (3 H, s), 3.45-3.38 (2 H, m), 2.77-2.74 (2 H, d, J=11.2 Hz), 2.14-2.01 (1 H, m), 1.94-1.89 (1 H, m), 1.57-1.55 (1 H, brs), 1.37-1.20 (2 H, m), 0.876 (3 H, d, J=9.2 Hz).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07084277B2uspto-grants-2006_08