반응 #710498

ord-d11eef648f3645f785f27b249355fa45

반응 방정식

O=C(O)c1ccc(C(F)(F)F)nc1Cl
2-chloro-6-(trifluoromethyl)nicotinic acid
B.C1CCOC1
BH3-THF
OCc1ccc(C(F)(F)F)nc1Cl
[2-chloro-6-(trifluoromethyl)pyridin-3-yl]methanol

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    농축After 16 h the reaction mixture was concentrated under reduced pressure
  2. 2
    기타to remove THF
  3. 3
    기타The resulting reaction mixture
  4. 4
    추출extracted with ethyl acetate (2×500 mL)
  5. 5
    세척The combined organic layers were washed with water (500 mL), brine (500 mL)
  6. 6
    건조dried over anhydrous sodium sulfate
  7. 7
    기타the solvent was removed under reduced pressure

실험 절차

To a stirred solution of e 2-chloro-6-(trifluoromethyl)nicotinic acid (Int-15) (40 g, 1.0 eq.) in THF (400 mL) was added BH3-THF (266.6 mL, 1.5 eq) at room temperature. The progress of the reaction was monitored by TLC. After 16 h the reaction mixture was concentrated under reduced pressure to remove THF. The resulting reaction mixture was diluted with 10% NaHCO3 (500 mL) and extracted with ethyl acetate (2×500 mL). The combined organic layers were washed with water (500 mL), brine (500 mL), dried over anhydrous sodium sulfate and the solvent was removed under reduced pressure to get crude [2-chloro-6-(trifluoromethyl)pyridin-3-yl]methanol (Int-16) as light yellow liquid, 32 g (85.5%).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US09301526B2uspto-grants-2016_04