반응 #706354

반응 방정식

ethyl 2-hydroxybenzoate

K2CO3

N-(3-chloropropyl)morpholine hydrochloride

→

ethyl 2-[3-(4-morpholinyl)propoxy]benzoate

용매

DMF

반응 조건

후처리

1. 1
   온도was warmed on a steam bath overnight
2. 2
   온도The reaction mixture was cooled
3. 3
   여과filtered
4. 4
   기타to afford a liquid which
5. 5
   기타was partitioned between EtOAc (350 ml) and water
6. 6
   기타The organic layer was separated
7. 7
   세척washed with water (2×200 ml)
8. 8
   건조dried over MgSO4

실험 절차

To a mixture of ethyl 2-hydroxybenzoate (2.4 ml, 16.38 mmol), K2CO3 (4.98 g), and DMF (30 ml) was added N-(3-chloropropyl)morpholine hydrochloride (3.93 g). The mixture was stirred at room temperature for 30 minutes, then was warmed on a steam bath overnight. The reaction mixture was cooled, filtered and stripped to afford a liquid which was partitioned between EtOAc (350 ml) and water. The organic layer was separated, washed with water (2×200 ml), dried over MgSO4 and stripped to afford ethyl 2-[3-(4-morpholinyl)propoxy]benzoate.

출처