반응 #696699

ord-e4cffc689b074805beb42db5135341c2

반응 방정식

[Na+].[OH-]
NaOH
CCC(Cc1ccccc1-c1ccccc1)C(=O)O
3-(2-biphenylyl)-2-ethylpropionic acid
O=S(Cl)Cl
thionyl chloride
CCC(Cc1ccccc1-c1ccccc1)C(=O)Cl
crude product
수율 106.3%
CCC(Cc1ccccc1-c1ccccc1)C(=O)Cl
3-(2-biphenylyl)-2-ethylpropionyl chloride
수율 106.3%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타To a 100-ml three-necked round flask (equipped with a stirrer tip
  2. 2
    온도were refluxed for 2.5 hours
  3. 3
    온도with heating in a nitrogen atmosphere
  4. 4
    workup.DISTILLATIONthe unreacted thionyl chloride was distilled off under reduced pressure

실험 절차

To a 100-ml three-necked round flask (equipped with a stirrer tip, a Dimroth condenser, a thermometer and a trap of NaOH) were introduced 13.3 g (52.4 mmol) of 3-(2-biphenylyl)-2-ethylpropionic acid and 25.9 ml (355 mmol) of thionyl chloride, and they were refluxed for 2.5 hours with heating in a nitrogen atmosphere. After the reaction was completed, the unreacted thionyl chloride was distilled off under reduced pressure to obtain 15.2 g of a crude product as a yellow orange liquid. This acid chloride was used for the next reaction without further purification. The properties of the product thus obtained are described below.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05998039uspto-grants-1999_12