반응 #69336

ord-4280198ea5c74381ad2e2a61578d701d

반응 방정식

CCOc1ccc2c(ccn2CN(C)C)c1
(5-ethoxy-1H-indol-ylmethyl)-dimethyl-amine
COC(=O)C(C)[N+](=O)[O-]
methyl 2-nitro-propionate
CC(C)=O.Cc1ccccc1
toluene acetone
CCOc1ccc2[nH]cc(CC(C)(C(=O)OC)[N+](=O)[O-])c2c1
(+/−)-3-(5-ethoxy-1H-indol-3-yl)-2-methyl-2-nitro-propionic acid methyl ester
수율 68.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도is refluxed
  2. 2
    온도is cooled
  3. 3
    세척It is subsequently washed with 10% aqueous HCl (2×10 ml), water (10 ml), 5% aqueous NaOH (2×10 ml), water (10 ml), and 20% aqueous Na2SO4 (10 ml)
  4. 4
    기타is dried
  5. 5
    기타the solvents are removed under reduced pressure
  6. 6
    기타The residue is purified by column chromatography (light petroleum-ethyl acetate, 4:1→7:3)

실험 절차

A mixture of (5-ethoxy-1H-indol-ylmethyl)-dimethyl-amine (2.18 g, 10 mmol) and commercially available methyl 2-nitro-propionate (1.60 g, 12 mmol, 1.2 equiv) in dry toluene (17 ml) is refluxed. When TLC (toluene-acetone, 9:1) indicates the absence of starting material the mixture is cooled and is diluted with chloroform (35 ml). It is subsequently washed with 10% aqueous HCl (2×10 ml), water (10 ml), 5% aqueous NaOH (2×10 ml), water (10 ml), and 20% aqueous Na2SO4 (10 ml), is dried, and the solvents are removed under reduced pressure. The residue is purified by column chromatography (light petroleum-ethyl acetate, 4:1→7:3) to give (+/−)-3-(5-ethoxy-1H-indol-3-yl)-2-methyl-2-nitro-propionic acid methyl ester (2.07 g, 68%) as a white solid. M.p. 80-82° C. (from ethyl acetate-hexane).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08530493B2uspto-grants-2013_09