반응 #6781

ord-3b8414190c404782927a055505deeae4

반응 방정식

Cl.NC(CO)(CO)CO
Tris HCl
[Cl-].[Cl-].[Mg+2]
MgCl2
CCCCC[C@H](O)/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C/CCCC(=O)O
[3H]PGD2
CCCCC[C@H](O)/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)O
PGD2

시약

없음

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타the mixture was reacted at 4° C. for 90 min
  2. 2
    기타After the reaction
  3. 3
    여과the mixture was filtered through a glass fiber
  4. 4
    여과filter paper
  5. 5
    세척washed several times
  6. 6
    온도with cooled physiological saline
  7. 7
    농축The inhibitory activity of each compound was expressed as the concentration

실험 절차

To a binding-reaction solution (50 mM Tris/HCl, pH 7.4, 5 mM MgCl2) (0.2 ml) were added the human platelet membrane fraction (0.1 mg) and 5 nM [3H]PGD2 (115 Ci/mmol), and the mixture was reacted at 4° C. for 90 min. After the reaction, the mixture was filtered through a glass fiber filter paper and washed several times with cooled physiological saline, then the radioactivity retained on the filter paper was measured. The specific-binding ratio was calculated by subtracting the non-specific binding ratio which is the radioactivity similarly measured in the presence of 10 μM PGD2 from the total binding. The inhibitory activity of each compound was expressed as the concentration required for 50% inhibition (IC50), which was determined by depicting a substitution curve by plotting the binding ratio (%) in the presence of each compound, where the binding ratio in the absence of a test compound is 100%.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07084136B2uspto-grants-2006_08