반응 #673395

ord-f7240c32783a4ccfa5aba91c88245ba0

반응 방정식

O=C(Cl)C(=O)Cl
oxalyl chloride
O=C(O)c1ccc(-c2ccncc2)cc1
4-(4-pyridyl)benzoic acid
O=C(Cl)C(=O)Cl
oxalyl chloride
O=S(=O)(c1ccc2cc(Br)ccc2c1)N1CCNC(CO)C1
2-(hydroxymethyl)-4-(6-bromonaphth-2-ylsulphonyl)piperazine
CCN(CC)CC
triethylamine
O=C(c1ccc(-c2ccncc2)cc1)N1CCN(S(=O)(=O)c2ccc3cc(Br)ccc3c2)CC1CO
1-(6-bromonaphth-2-ylsulphonyl)-3-(hydroxymethyl)-4-[4-(4-pyridyl)benzoyl] piperazine
수율 56.6%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.STIRRINGthe suspension stirred a further 4 hours
  2. 2
    기타The solvent was removed in vacuo
  3. 3
    기타the residue, after drying
  4. 4
    workup.STIRRINGAfter stirring at room temperature overnight the reaction mixture
  5. 5
    여과was filtered off
  6. 6
    기타dried
  7. 7
    기타recrystallised from ethyl acetate (10 ml)

실험 절차

A stirred suspension of 4-(4-pyridyl)benzoic acid (sodium salt) (190 mg, 0.86 mmol) in dichloromethane (10 ml) was treated with oxalyl chloride (0.2 ml, 2.3 mmol) and DMF (catalytic amount). After stirring for 2 hours, further oxalyl chloride 0.2 ml, 2.3 mmol) and DMF (catalytic amount) was added and the suspension stirred a further 4 hours. The solvent was removed in vacuo and the residue, after drying, was suspended in dichloromethane (20 ml) and treated with 2-(hydroxymethyl)-4-(6-bromonaphth-2-ylsulphonyl)piperazine (300 mg, 0.78 mmol) and triethylamine (0.36 ml, 2.5 mmol). After stirring at room temperature overnight the reaction mixture was diluted with dichloromethane (20 ml) and water (20 ml). A copious precipitate appeared which was filtered off, dried and recrystallised from ethyl acetate (10 ml) to yield 1-(6-bromonaphth-2-ylsulphonyl)-3-(hydroxymethyl)-4-[4-(4-pyridyl)benzoyl] piperazine as a colourless solid (250 mg); 1H NMR (300 MHz, DMSO-d6) δ=3-4 ppm (broad, 9H), δ7.2 ppm (d, 2H), δ=7.7 ppm (d, 2H), δ=7.8 ppm (m, 4H), δ=8.2 ppm (t, 2H), δ8.4 ppm (s,1H), δ=8.45 ppm (s,1H), δ=8.6 ppm (d, 2H); signals due ethyl acetate (1 mol eq) were also present; MS: (M+H)+ 566/568 (1 Br pattern); analysis; found: C, 56.8; H, 4.9; N, 6.3%; C27H24BrN3SO4. C4H8O2 requires: C, 56.9; H, 4.9; H, 4.9; N, 6.4%.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06936610B2uspto-grants-2005_08