반응 #662226

ord-64836001e655436f8ca762236a91e45f

반응 방정식

COC(=O)c1cn2c(n1)-c1cc(Br)c(F)cc1C1CC2C1
methyl 9-bromo-10-fluoro-2,5-diazatetracyclo[11.1.1.0[2,6].0[7,12]]pentadeca-3,5,7,9,11-pentaene-4-carboxylate
O=C(O)c1cn2c(n1)-c1cc(Br)c(F)cc1C1CC2C1
9-bromo-10-fluoro-2,5-diazatetracyclo[11.1.1.0[2,6].0[7,12]]pentadeca-3,5,7,9,11-pentaene-4-carboxylic acid
수율 86.2%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타Into a 5000-mL 4-necked round-bottom flask was placed
  2. 2
    온도The resulting solution was heated
  3. 3
    온도to reflux for 1.5 hours
  4. 4
    농축concentrated under vacuum
  5. 5
    여과The precipitates were collected by filtration
  6. 6
    세척washed with 1×1000 mL of water
  7. 7
    기타dried

실험 절차

Into a 5000-mL 4-necked round-bottom flask was placed a solution of methyl 9-bromo-10-fluoro-2,5-diazatetracyclo[11.1.1.0[2,6].0[7,12]]pentadeca-3,5,7,9,11-pentaene-4-carboxylate (110 g, 313.24 mmol, 1.00 equiv) in methanol/NaOH (40%) (1000 mL). The resulting solution was heated to reflux for 1.5 hours and concentrated under vacuum. Hydrogen chloride (2 mol/L) was used to adjust the pH to 4. The precipitates were collected by filtration, washed with 1×1000 mL of water and dried to afford 91 g (86%) of 9-bromo-10-fluoro-2,5-diazatetracyclo[11.1.1.0[2,6].0[7,12]]pentadeca-3,5,7,9,11-pentaene-4-carboxylic acid as a white solid.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US09034866B2uspto-grants-2015_05