반응 #640605

ord-4b028e7fc28b4323bf74e2fb9113f99c

반응 방정식

CCOC(=O)c1noc2c1CN(C(=O)OC(C)(C)C)CC2
6,7-dihydro-4H-isoxazolo[4,5-c]pyridine-3,5-dicarboxylic acid 3-ethyl ester 5-tert-butyl ester
[Li+].[OH-]
lithium hydroxide
CC(C)(C)OC(=O)N1CCc2onc(C(=O)O)c2C1
6,7-dihydro-4H-isoxazolo[4,5-c]pyridine-3,5-dicarboxylic acid 5-tert-butyl ester

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타The solvent was removed under a vacuum
  2. 2
    workup.DISSOLUTIONthe residue redissolved in a mixture of water/citric acid (pH=4) and ether
  3. 3
    기타The organic phase was separated off
  4. 4
    건조dried over magnesium sulfate
  5. 5
    기타the solvent was removed under a vacuum

실험 절차

A mixture of 7.31 g (25 mmol) of 6,7-dihydro-4H-isoxazolo[4,5-c]pyridine-3,5-dicarboxylic acid 3-ethyl ester 5-tert-butyl ester (E), 43 g (30 mmol) of lithium hydroxide and 75 mL of EtOH was stirred at RT for 12 h. The solvent was removed under a vacuum and the residue redissolved in a mixture of water/citric acid (pH=4) and ether. The organic phase was separated off, dried over magnesium sulfate and the solvent was removed under a vacuum. 6.65 g (99% of theoretical) of the desired product 6,7-dihydro-4H-isoxazolo[4,5-c]pyridine-3,5-dicarboxylic acid 5-tert-butyl ester (F) were obtained in the form of a yellow oil which crystallised at RT.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08048879B2uspto-grants-2011_11