반응 #619117

ord-f9113b5512f148d48ddaeec6a083998c

반응 방정식

CCOC(=O)C=Cc1cnc(NC(=O)N(C2CCCCC2)C2CCCCC2)s1
3-[2-(3,3-dicyclohexylureido)-thiazol-5-yl]-acrylic acid ethyl ester
CCOC(=O)CCc1cnc(NC(=O)N(C2CCCCC2)C2CCCCC2)s1
3-[2-(3,3-dicyclohexylureido)-thiazol-5-yl]-propionic acid ethyl ester
수율 47.7%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타The content was degassed
  2. 2
    여과The mixture was filtered through celite
  3. 3
    농축the filtrate was concentrated
  4. 4
    기타The residue was further purified by flash chromatography (silica, CH2Cl2-EtOAc 4:1

실험 절차

To a solution of 3-[2-(3,3-dicyclohexylureido)-thiazol-5-yl]-acrylic acid ethyl ester (Example 257) (75 mg, 0.18 mmol) in methanol was added Pd/C (150 mg). The content was degassed and was placed under hydrogen atmosphere for 12 h. The mixture was filtered through celite, and the filtrate was concentrated. The residue was further purified by flash chromatography (silica, CH2Cl2-EtOAc 4:1 to give 3-[2-(3,3-dicyclohexylureido)-thiazol-5-yl]-propionic acid ethyl ester (35 mg) in 47% yield.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: USRE045183E1uspto-grants-2014_10