반응 #56586

ord-01e0b3a578a34c49bce262894dec7794

반응 방정식

CCN(CC)CC
Triethylamine
CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](N)c3ccccc3)C(=O)N2[C@H]1C(=O)O
ampicillin
CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)O
z,z,z-octadeca-6,9,12-trienoic acid
C1CCOC1.CCCCCC
THF hexane
CC1(C)SC2C(NC(=O)C(N)c3ccccc3)C(=O)N2C1C(=O)O.CCCCC/C=C\C/C=C\C/C=C\CCCCC(N)=O
6-[(aminophenylacetyl) amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid z,z,z-octadeca-6,9,12-trienamide

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도while maintaining
  2. 2
    기타the reaction at 0-10° C
  3. 3
    기타had reacted
  4. 4
    workup.STIRRINGthe contents stirred
  5. 5
    추출extracted with ethyl acetate
  6. 6
    세척The extract was washed with water
  7. 7
    건조dried (sodium sulfate)
  8. 8
    농축concentrated to dryness
  9. 9
    기타leaving the crude product as a yellow glass

실험 절차

Triethylamine (0.3 ml) was added to a stirred suspension of ampicillin (0.7 g) in anhydrous DMF (120 ml) under a nitrogen atmosphere. To the resultant clear solution was added z,z,z-octadeca-6,9,12-trienoic acid, N-hydroxysuccinimide ester (0.75 g) while maintaining the reaction at 0-10° C. The reaction was stirred at this temperature for an additional hour before allowing the mixture to stand at room temperature overnight. Tlc analysis (40% THF/hexane) at this point indicated that most of the succinimide ester had reacted. Water (40 ml) was added to the reaction flask and the contents stirred. The solution was then neutralised and extracted with ethyl acetate. The extract was washed with water, dried (sodium sulfate) and concentrated to dryness leaving the crude product as a yellow glass. Trituration with hexane yielded 6-[(aminophenylacetyl) amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid-z,z,z-octadeca-6,9,12-trienamide as a yellow powder.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: USRE040480E1uspto-grants-2008_09