반응 #554587

ord-877465121960494d97c0db5ab19ec7b8

반응 방정식

CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)CO
glyceryl monooleate
O=C1CCC(=O)O1
succinic anhydride
O=C1CCC(=O)O1
succinic anhydride
CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)CO.O=C([O-])CCC(=O)[O-]
glyceryl monooleate succinate

반응 조건

온도
140°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONwas added
  2. 2
    기타a nitrogen inlet adapter was attached
  3. 3
    기타was placed into a room temperature
  4. 4
    온도the temperature was raised to 200° C
  5. 5
    온도Heat tape
  6. 6
    기타The flask was removed from the oil bath
  7. 7
    온도to cool to room temperature

실험 절차

30.0 gm (84.1 mmoles) of glyceryl monooleate were added to a dry 100 ml, single neck, round bottom flask. A football stir bar was added and a nitrogen inlet adapter was attached. The reaction flask was placed into a room temperature oil bath and a nitrogen blanket was applied. The oil bath temperature was raised to 140° C. Once at 140° C., 8.42 gm (84.1 mmoles) succinic anhydride was added and the temperature was raised to 200° C. Heat tape was wrapped around the outside of the top of the flask and adapter to keep the succinic anhydride from subliming. The reaction was continued for 3 hours at 200° C. The flask was removed from the oil bath and allowed to cool to room temperature. The polymer was a pale yellow, viscous liquid.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08623413B2uspto-grants-2014_01