반응 #553447

ord-920c634ef74d49109dbf00fb319e43d0

반응 방정식

O=[N+]([O-])O
nitric acid
O=C(O)c1ccccc1C(=O)O
phthalic acid
O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O
3- nitrophthalic acid

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONeach added to a reaction vessel
  2. 2
    기타brought to a temperature of 70° C
  3. 3
    기타produces
  4. 4
    기타yields of greater than 90%
  5. 5
    기타of theoretical yield
  6. 6
    workup.ADDITIONmix in mole percent

실험 절차

100 parts by weight and 150 parts by weight 99% by weight concentrated nitric acid are each added to a reaction vessel and brought to a temperature of 70° C. To each solution is added 10 parts by weight phthalic acid. Nitration is allowed to continue at 70° C. for three hours and produces yields of greater than 90% of theoretical yield consisting essentially of a mixture of 3- and 4- nitrophthalic acid. Table 1 shows the make-up of the reaction product mix in mole percent. The mole ratio of 4- to 3- nitrophthalic acid formed was approximately 1.1:1.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05155234uspto-grants-1992_10