반응 #5492

ord-6d7f78a9e4854515844933e38954e2d1

반응 방정식

CC(=O)SC[C@H]1CCCCCC[C@H](C(=O)O)NC1=O
Trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxylic acid
CN1CCOCC1
4-Methylmorpholine
CCOC(=O)Cl
Ethyl chloroformate
CC(=O)SC[C@H]1CCCCCC[C@H](C(N)=O)NC1=O
trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxamide

반응 조건

온도
-20°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    여과The reaction is then filtered
  2. 2
    농축the filtrate is concentrated
  3. 3
    기타to give a yellow oil
  4. 4
    기타anhydrous ammonia gas is bubbled through the solution for 1 hour
  5. 5
    workup.STIRRINGthe reaction is stirred an additional 1 hour
  6. 6
    기타The solvent is evaporated
  7. 7
    기타the residue is partitioned between ethyl acetate and water
  8. 8
    추출The aqueous layer is extracted several times with ethyl acetate
  9. 9
    건조the combined organic layers are dried (Na2SO4)
  10. 10
    기타the solvent is evaporated

실험 절차

Trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxylic acid (0.30 g, 1.05 mmol) is dissolved in tetrahydrofuran (5.0 mL). 4-Methylmorpholine (0.14 mL, 1.05 mmol) is then added, and the reaction is cooled to -20° C. Ethyl chloroformate (0.1 mL, 1.05 mmol) is then added, and the reaction is stirred at -20° C. for 30 minutes. The reaction is then filtered, and the filtrate is concentrated to give a yellow oil. This oil is dissolved in methylene chloride (20.0 mL), and anhydrous ammonia gas is bubbled through the solution for 1 hour. The bubbling is stopped, and the reaction is stirred an additional 1 hour. The solvent is evaporated, and the residue is partitioned between ethyl acetate and water. The aqueous layer is extracted several times with ethyl acetate, the combined organic layers are dried (Na2SO4), and the solvent is evaporated to give trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxamide, MS:M+1=287.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US05244889uspto-grants-1993_09