반응 #51520

ord-507d08c893fa43438ae148c37145f8eb

반응 방정식

O=C(Cl)c1ccccc1
benzoyl chloride
C[Si](C)(C)Cl
Trimethylchlorosilane
O=C(Cl)c1ccccc1
benzoyl chloride
[NH4+].[OH-]
NH4OH
C=CCO[C@H]1[C@@H](O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO
3′-O-allyl adenosine
O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
P2O5
C=CCO[C@H]1[C@@H](O)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO
title compound
수율 62.0%
C=CCO[C@H]1[C@@H](O)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO
3′-O-allyl-N6-benzoyl adenosine
수율 62.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타was brought to room temperature
  2. 2
    workup.STIRRINGstirred for 4 hrs
  3. 3
    기타Then the reaction mixture was brought to 0° C. in an ice bath
  4. 4
    workup.STIRRINGthe reaction mixture was stirred for 30 minutes
  5. 5
    기타at 0° C.
  6. 6
    workup.STIRRINGstirring for an additional 1 hr
  7. 7
    기타Solvent evaporated residue
  8. 8
    기타partitioned between water and ether
  9. 9
    기타Product precipitates as an oil, which
  10. 10
    기타was then chromatographed (5% MeOH in CH2Cl2)

실험 절차

2′/3′-O-allyl adenosine (15.19 g, 51.1 mmol) was dried over P2O5 under high vacuum overnight at 40° C. It was then dissolved in anhydrous pyridine (504.6 mL) under inert atmosphere. Trimethylchlorosilane (32.02 mL, 252.3 mmol) was added at 0° C. and the reaction mixture was stirred for 1 hr under inert atmosphere. Then benzoyl chloride (29.4 mL, 252.3 mmol) was added dropwise. Once the addition of benzoyl chloride was over, the reaction mixture was brought to room temperature and stirred for 4 hrs. Then the reaction mixture was brought to 0° C. in an ice bath. Water (100.9 mL) was added and the reaction mixture was stirred for 30 minutes. Then NH4OH (100.0 mL, 30% aqueous solution w/w) was added, keeping the reaction mixture at 0° C. and stirring for an additional 1 hr. Solvent evaporated residue partitioned between water and ether. Product precipitates as an oil, which was then chromatographed (5% MeOH in CH2Cl2) to get the title compound as a white foam (12.67 g, 62%).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06849723B2uspto-grants-2005_02