반응 #487555

ord-61be4968a74b463195197dfc717efde7

반응 방정식

CCc1ccc(-c2ccc(Cl)cc2)cc1[N+](=O)[O-]
4′-Chloro-4-ethyl-3-nitrobiphenyl
O
water
[Cl-].[NH4+]
ammonium chloride
CCc1ccc(-c2ccc(Cl)cc2)cc1N
3-amino-4′-chloro-4-ethylbiphenyl
수율 75.3%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도the mixture is heated
  2. 2
    온도to reflux for 1 hour
  3. 3
    온도The reaction mixture is cooled to room temperature
  4. 4
    여과filtered through diatomaceous earth
  5. 5
    기타the filtrate is evaporated in vacuo
  6. 6
    기타to remove most of the methanol
  7. 7
    기타The residue is partitioned between ethyl acetate (200 ml) and water
  8. 8
    추출the aqueous phase is re-extracted with ethyl acetate (200 ml)
  9. 9
    세척washed with water and brine
  10. 10
    건조dried over anhydrous magnesium sulfate
  11. 11
    여과filtered
  12. 12
    기타the filtrate is evaporated in vacuo

실험 절차

4′-Chloro-4-ethyl-3-nitrobiphenyl (22.6 g, 0.086 mol) is suspended in methanol (250 ml) and the reaction mixture is stirred at room temperature. Distilled water (100 ml) is added, followed by zinc dust (39.0 g, 0.60 mol) and ammonium chloride (13.8 g, 0.26 mol) and the mixture is heated to reflux for 1 hour. The reaction mixture is cooled to room temperature, filtered through diatomaceous earth and the filtrate is evaporated in vacuo to remove most of the methanol. The residue is partitioned between ethyl acetate (200 ml) and water and the aqueous phase is re-extracted with ethyl acetate (200 ml). The organic extracts are combined, washed with water and brine, dried over anhydrous magnesium sulfate, filtered and the filtrate is evaporated in vacuo to give 3-amino-4′-chloro-4-ethylbiphenyl (15.0 g) as a colourless solid. The product is used directly without further purification in Step 5.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08741806B2uspto-grants-2014_06