반응 #481907

ord-865809982dde4a86acbf5c0e36b19187

반응 방정식

Nc1ccc2c(Nc3cccc(Br)c3)ncnc2c1
7-amino-4-(3-bromoanilino)-quinazoline
C/C=C/C(=O)Cl
crotonic acid chloride
CC=CC(=O)Nc1ccc2c(Nc3cccc(Br)c3)ncnc2c1
desired product
수율 31.2%
CC=CC(=O)Nc1ccc2c(Nc3cccc(Br)c3)ncnc2c1
But-2-enoic acid [4-(3-bromo-phenylamino)-quinazolin-7-yl]-amide
수율 31.2%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONWhen the addition
  2. 2
    기타the ice bath was removed
  3. 3
    여과The reaction was filtered
  4. 4
    기타to remove the yellow solid which
  5. 5
    세척was washed with tetrahydrofuran
  6. 6
    기타recrystallized from 20 mL of boiling methanol

실험 절차

To an ice cold solution of 0.158 g of 7-amino-4-(3-bromoanilino)-quinazoline (J Med Chem, 1985:3482) in 5 mL of tetrahydrofuran was added dropwise a solution of 0.105 g of crotonic acid chloride in 5 mL of tetrahydrofuran. When the addition was complete, the ice bath was removed and the reaction stirred at room temperature for 15 hours. The reaction was filtered to remove the yellow solid which was washed with tetrahydrofuran and recrystallized from 20 mL of boiling methanol to afford 0.060 g of the desired product, mp >250° C.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06602863B1uspto-grants-2003_08