반응 #481613

ord-188ba38aee054365849e8b30ebbfb5f1

반응 방정식

CCCCCCCCCCCCCCCCCC(=O)OC
methyl stearate
CCCCCCCC/C=C\CCCCCCCC(=O)OC
methyl oleate
CCCCC/C=C\C/C=C\C/C=C\CCCCCCC(=O)O
DGLA

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타Methyl ester of DGLA is recovered preferably
  2. 2
    추출by extracting the above-mentioned treated solution with an organic solvent such as hexane
  3. 3
    추출Next, the resulting extract
  4. 4
    건조is dried on, for example, anhydrous sodium sulfate
  5. 5
    workup.DISTILLATIONthe solvent is distilled off preferably under reduced pressure
  6. 6
    기타to obtain a mixture

실험 절차

Methyl ester of DGLA is recovered preferably by extracting the above-mentioned treated solution with an organic solvent such as hexane, an ether such as ethyl ether, or an ester such as ethyl acetate. Next, the resulting extract is dried on, for example, anhydrous sodium sulfate, and the solvent is distilled off preferably under reduced pressure to obtain a mixture comprising fatty acid esters. This mixture contains, in addition to the desired fatty acid HGLA methyl ester, other fatty acid methyl esters, such as methyl parmitate, methyl stearate, methyl oleate and the like. To isolate methyl ester of DGLA from the mixture of these fatty acid methyl esters, column chromatography, low temperature crystallization, the urea-inclusion method, the liquid/liquid countercurrent chromatography method, and the like can be used alone or in combination.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06602690B2uspto-grants-2003_08