반응 #470394

ord-a3a8d3c2613447acba254d6162d7c5c4

반응 방정식

CC(C)c1cccc(C(C)C)c1Nc1ccccc1N
N1-(2,6-diisopropylphenyl)benzene-1,2-diamine
CC(C)c1cccc(C(C)C)c1-n1c(-c2ccccc2)nc2ccccc21
desired product
수율 59.9%
CC(C)c1cccc(C(C)C)c1-n1c(-c2ccccc2)nc2ccccc21
1-(2,6-diisopropylphenyl)-2-phenyl-1H-benzo[d]imidazole
수율 59.9%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도under reflux for 3 hours
  2. 2
    온도The reaction mixture was heated up again
  3. 3
    온도to reflux overnight
  4. 4
    기타Air was bubbled through the reaction
  5. 5
    온도while reflux
  6. 6
    기타The solvent was evaporated
  7. 7
    workup.DISSOLUTIONThe residue was dissolved in dichloromethane (200 mL)
  8. 8
    기타The crude product was purified by column chromatography

실험 절차

N1-(2,6-diisopropylphenyl)benzene-1,2-diamine (8.5 g, 32 mmol) and benzldehyde (3 g, 28.8 mmol) were reacted in acetonitrile (100 ml) under reflux for 3 hours. The reaction mixture was cooled to room temperature. Ferric chloride (0.05 g, 0.28 mmol) was added. The reaction mixture was heated up again to reflux overnight. Air was bubbled through the reaction while reflux. The solvent was evaporated. The residue was dissolved in dichloromethane (200 mL) and ran through a short silica gel plug. The crude product was purified by column chromatography using dichloromethane to 3% of ethyl acetate in dichloromethane. 3.4 g of desired product was obtained.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08367223B2uspto-grants-2013_02