반응 #46949

ord-150a6b8f1f4845b28c74e8942d562525

반응 방정식

COc1cc(C(C)C)c(O)cc1I
5-iodo-2-isopropyl-4-methoxy-phenol
CC(C)(C)[O-].[K+]
KOtBu
[O-]c1ccccc1
phenoxide
Cc1ccc(S(=O)(=O)OCC#N)cc1
toluene-4-sulfonic acid cyanomethyl ester
COc1cc(C(C)C)c(OCC#N)cc1I
(5-iodo-2-isopropyl-4-methoxy-phenoxy)-acetonitrile
수율 82.0%

용매

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타did not exceed 6 degrees C
  2. 2
    기타The reaction mixture was partitioned between n-heptane (50 mL) and water (50 mL)
  3. 3
    workup.DISTILLATIONthe organic layer was displaced into n-heptane by distillation (to a pot temperature of 97 degrees C
  4. 4
    농축The concentrate in n-heptane
  5. 5
    온도was cooled slowly to ambient temperature
  6. 6
    세척the resulting crystalline solid was washed with n-heptane
  7. 7
    기타dried

실험 절차

To a cold (1 degree C.) solution of 10.0 g of 5-iodo-2-isopropyl-4-methoxy-phenol in 25 mL THF was added 41.3 mL of 1N KOtBu in THF at a rate such that the internal temperature did not exceed 6 degrees C. To the resultant phenoxide solution was added a solution of 7.2 g of toluene-4-sulfonic acid cyanomethyl ester in 25 mL THF, and the reaction mixture was allowed to warm slowly to ambient temperature overnight. The reaction mixture was partitioned between n-heptane (50 mL) and water (50 mL), and the organic layer was displaced into n-heptane by distillation (to a pot temperature of 97 degrees C.). The concentrate in n-heptane was cooled slowly to ambient temperature and the resulting crystalline solid was washed with n-heptane and dried. In this manner, 9.26 g of (5-iodo-2-isopropyl-4-methoxy-phenoxy)-acetonitrile was isolated (81%): m.p. 67.5-68.8 degrees C.; 1H nmr (DMSO) delta: 1.18 (d, 6H, J=6.9 Hz), 3.19 (septet, 1H, J=6.9 Hz), 3.81 (s, 3H), 5.16 (s 2H), 6.88 (s, 1H), 7.50 (s, 1H).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07741484B2uspto-grants-2010_06