반응 #463433

ord-11271ffa8afd4c7da6c27ef32e409b42

반응 방정식

CC(C)[N-]C(C)C.[Li+]
Lithium diisopropylamide
CCOC(=O)Cc1c(F)cccc1Cl
ethyl (2-chloro-6-fluorophenyl)acetate
CC1CCC(C(=O)Cl)CC1
4-Methylcyclohexanecarboxylic acid chloride
CCOC(=O)C(C(=O)C1CCC(C)CC1)c1c(F)cccc1Cl
oil
수율 106.5%
CCOC(=O)C(C(=O)C1CCC(C)CC1)c1c(F)cccc1Cl
ethyl 2-(2-chloro-6-fluorophenyl)-3-(4-methylcyclohexyl)-3-oxopropionate
수율 106.5%

반응 조건

온도
-70°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    온도to warm up to room temperature over night
  2. 2
    기타The reaction mixture is then quenched with hydrochloric acid (5N, 60 ml) and most of the organic solvent
  3. 3
    workup.DISTILLATIONis distilled off under reduced pressure
  4. 4
    추출From the remainder the product is extracted with light petroleum (200 ml)
  5. 5
    기타The organic layer is separated
  6. 6
    세척washed with water
  7. 7
    건조dried with magnesium sulphate
  8. 8
    농축concentrated in vacuo

실험 절차

Lithium diisopropylamide (0.18 mol) in tetrahydrofuran (270 ml) is added to a mixture of ethyl (2-chloro-6-fluorophenyl)acetate (38.1 g, 0.175 mol) and THF (200 ml) at -70° C. The reaction mixture is stirred for 2 hours at about -70° C. 4-Methylcyclohexanecarboxylic acid chloride (28.25 g, 0.175 mol) is added and the reaction mixture is allowed to warm up to room temperature over night. The reaction mixture is then quenched with hydrochloric acid (5N, 60 ml) and most of the organic solvent is distilled off under reduced pressure. From the remainder the product is extracted with light petroleum (200 ml). The organic layer is separated, washed with water, dried with magnesium sulphate and concentrated in vacuo to yield a yellow oil (63.5 g). This is filtered through silica (light petroleum, 3% ethyl acetate) to yield a pale yellow oil (27.2 g). The product is used in the next step without further purification.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US06020338uspto-grants-2000_02