반응 #46093

ord-362936ede8234b00bc667f0948035770

반응 방정식

O=C1CC[C@@H](C(=O)O)N1
L-pyroglutamic acid
Cc1ccc(S(=O)(=O)O)cc1.O
para-toluenesulfonic acid mono hydrate
CC(C)OC(=O)[C@@H]1CCC(=O)N1
isopropyl pyrrolidin-5-one-2(S)-carboxylate

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.ADDITIONfilled with 4 Å molecular sieves)
  2. 2
    세척washed with saturated aqueous sodium bicarbonate
  3. 3
    건조saturated aqueous NaCl, dried (MgSO4)
  4. 4
    기타evaporated
  5. 5
    기타to give a colorless syrup
  6. 6
    기타It crystallized
  7. 7
    기타Triturating the crystalline residue in hexane

실험 절차

A solution of L-pyroglutamic acid (Aldrich, 25.0 g, 195 mmol) and para-toluenesulfonic acid mono hydrate (3.71 g, 19.5 mmol) was refluxed in isopropanol (40 mL) under nitrogen for 6 hours using a Dean-Stark trap variation (condensate returned through a Soxhlet extractor filled with 4 Å molecular sieves). After cooling to room temperature, the reaction was diluted with ether, washed with saturated aqueous sodium bicarbonate and then saturated aqueous NaCl, dried (MgSO4) and evaporated to give a colorless syrup. It crystallized upon setting. Triturating the crystalline residue in hexane provided 31.9 g (96%) of isopropyl pyrrolidin-5-one-2(S)-carboxylate as white prisms: 1H NMR (300 MHz, Chloroform-D) δ 6.35 (br s, 1 H), 5.04 (sept. 1H, J=6.2 Hz), 4.18 (dd, 1H, J=8.4, 5.3 Hz), 2.51-2.28 (m, 3H), 2.27-2.12 (m, 1H), 1.24 (d, 6H, J=6.2 Hz). LCMS m/z 172 (M+H)+.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07741281B2uspto-grants-2010_06