반응 #43904

ord-2a1df406ea014e3a9a027934d28b764a

반응 방정식

Cl
hydrochloric acid
CC(C)OB(OC(C)C)OC(C)C
Triisopropyl borate
Cc1cc(OC2CCSCC2)cc(C)c1Br
4-(4-bromo-3,5-dimethylphenoxy)tetrahydro-2H-thiopyran
CCCCCC.[Li][CH2]CCC
n-butyllithium hexane
Cc1cc(OC2CCSCC2)cc(C)c1B(O)O
title compound
수율 71.0%
Cc1cc(OC2CCSCC2)cc(C)c1B(O)O
[2,6-dimethyl-4-(tetrahydro-2H-thiopyran-4-yloxy)phenyl]boronic acid
수율 71.0%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    workup.STIRRINGthe mixture was stirred overnight, during which the mixture
  2. 2
    온도cooled
  3. 3
    workup.STIRRINGthe mixture was stirred for 2.5 hr
  4. 4
    기타The aqueous layer and the organic layer were separated
  5. 5
    세척the organic layer was washed with saturated brine and saturated aqueous sodium hydrogencarbonate
  6. 6
    건조The organic layer was dried over anhydrous magnesium sulfate
  7. 7
    농축concentrated under reduced pressure
  8. 8
    세척The residue was washed with cool hexane

실험 절차

To a solution of 4-(4-bromo-3,5-dimethylphenoxy)tetrahydro-2H-thiopyran (3.01 g, 10.0 mmol) in tetrahydrofuran (50 mL) was added dropwise n-butyllithium hexane solution (1.6 M, 6.57 mL, 10.5 mmol) at −78° C., and the reaction mixture was stirred for 1.5 hr at the same temperature. Triisopropyl borate (6.92 mL, 30.0 mmol) was added, and the mixture was stirred overnight, during which the mixture was allowed to warm to room temperature. The reaction mixture was ice-cooled, 2 M hydrochloric acid (50 mL) was added, and the mixture was stirred for 2.5 hr. The aqueous layer and the organic layer were separated, and the organic layer was washed with saturated brine and saturated aqueous sodium hydrogencarbonate while simultaneously adjusting to neutral. The organic layer was dried over anhydrous magnesium sulfate, and concentrated under reduced pressure. The residue was washed with cool hexane to give the title compound (1.89 g, yield 71%) as colorless crystals.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07732626B2uspto-grants-2010_06