반응 #42868

ord-8a2483aa85a646cbbd1dd630a3ffbad5

반응 방정식

COC(=O)c1cscc1NC(=O)COc1ccc(I)cc1
4-[2-(4-iodo-phenoxy)-acetylamino]-thiophene-3-carboxylic acid methyl ester
OB(O)c1ccc(F)cc1
4-fluorophenylboronic acid
O=C([O-])[O-].[Cs+].[Cs+]
cesium carbonate
COC(=O)c1cscc1NC(=O)COc1ccc(-c2ccc(F)cc2)cc1
title compound
수율 124.3%
COC(=O)c1cscc1NC(=O)COc1ccc(-c2ccc(F)cc2)cc1
4-[2-(4′-Fluoro-biphenyl-4-yloxy)-acetylamino]-thiophene-3-carboxylic acid methyl ester
수율 124.3%

반응 조건

온도
80°CELSIUS
상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타The solution was then degassed
  2. 2
    기타by bubbling a flux of argon for 20 minutes
  3. 3
    온도to cool down to room temperature
  4. 4
    여과The reaction mixture was then filtered
  5. 5
    세척the filtrate was then washed twice with brine
  6. 6
    건조dried over sodium sulfate
  7. 7
    농축before being concentrated in vacuo
  8. 8
    여과The residue was then filtered through a pad of silica (SiO2, EtOAc, 100%)

실험 절차

To a solution of 4-[2-(4-iodo-phenoxy)-acetylamino]-thiophene-3-carboxylic acid methyl ester (0.1 g, 0.428 mmol) in a mixture of tetrahydrofuran (21 mL) and water (5 mL) was added 4-fluorophenylboronic acid (40.3 mg, 0.288 mmol) and cesium carbonate (313 mg, 0.96 mmol). The solution was then degassed by bubbling a flux of argon for 20 minutes before adding polymer bound tetrakis(triphenylphosphine)palladium (Aldrich-511579, 12.86 mg, 0.009 mmol). The reaction mixture was then stirred for 90 min at 80° C. under argon atmosphere before allowing to cool down to room temperature and diluting with ethyl acetate. The reaction mixture was then filtered; the filtrate was then washed twice with brine and dried over sodium sulfate before being concentrated in vacuo. The residue was then filtered through a pad of silica (SiO2, EtOAc, 100%) to yield the title compound as a light brown solid (138 mg, 99%).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07732452B2uspto-grants-2010_06