반응 #422845

ord-20fdeaec27664a1d8a3f50b8a635582c

반응 방정식

O=S(Cl)Cl
Thionyl chloride
COc1ccc2cc([C@H](C)C(=O)O)ccc2c1
(S)-(+)-2-(6-methoxy-naphthalen-2-yl)-propionic acid
CN(C)C=O
DMF
COc1ccc2cc([C@H](C)C(=O)Cl)ccc2c1
(S)-2-(6-methoxy-naphthalen-2-yl)-propionyl chloride
수율 88.8%

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타equipped with magnetic stirring
  2. 2
    온도the mixture was refluxed for 3 hours
  3. 3
    workup.DISTILLATIONChloroform and excess thionyl chloride were distilled from the reaction mixture while methylene chloride
  4. 4
    workup.ADDITIONwas added
  5. 5
    기타Evaporation of residual solvent

실험 절차

Compound 2 was prepared from the corresponding carboxylic acid. Thionyl chloride (1.24 g, 10.42 mmoles) was added to a solution of (S)-(+)-2-(6-methoxy-naphthalen-2-yl)-propionic acid (Naproxen, 2 g, 8.69 mmoles) in 8.2 mL chloroform in a round bottom flask equipped with magnetic stirring. A drop of DMF was added and the mixture was refluxed for 3 hours. Chloroform and excess thionyl chloride were distilled from the reaction mixture while methylene chloride was added. Evaporation of residual solvent yielded (S)-2-(6-methoxy-naphthalen-2-yl)-propionyl chloride (1.918 g, 88.8% yield). Rf=0.2 (1:1 hexanes:ethyl ether). 1H NMR (400 MHz, CDCl3) δ 9.98 (br, 1H), 7.78 (t, 2H), 7.36 (d, 1H), 7.18 (d, 1H), 7.14 (m, 2H), 4.25 (q, 1H), 3.93 (s, 3H), 1.68 (d, 3H).

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US08884060B2uspto-grants-2014_11