반응 #41537

ord-39773446c1b64b71b3c66c90f66f485a

반응 방정식

COCCl
chloromethyl methyl ether
[H-].[Na+]
sodium hydride
C1CCOC1
tetrahydrofuran
CCOC(=O)c1ccc(O)c(Br)c1
ethyl 3-bromo-4-hydroxybenzoate
CCOC(=O)c1ccc(OCOC)c(Br)c1
compound
CCOC(=O)c1ccc(OCOC)c(Br)c1
ethyl 3-bromo-4-methoxymethoxybenzoate

반응 조건

상세 조건
See reaction.notes.procedure_details.

후처리

  1. 1
    기타produced
  2. 2
    온도437, with cooling with ice
  3. 3
    기타the reaction liquid
  4. 4
    기타the reaction liquid
  5. 5
    workup.STIRRINGwas stirred overnight at room temperature
  6. 6
    기타The reaction liquid
  7. 7
    세척washed with water
  8. 8
    추출the aqueous layer was extracted with ethyl acetate
  9. 9
    건조dried with anhydrous magnesium sulfate
  10. 10
    기타The solvent was evaporated away under reduced pressure
  11. 11
    여과taken out through filtration

실험 절차

5.5 g of sodium hydride was added to a tetrahydrofuran (300 ml) solution of 20.5 g of ethyl 3-bromo-4-hydroxybenzoate produced according to the method described in Monatsh. Chem.; 22; 1901; 437, with cooling with ice, and the reaction liquid was stirred for 30 minutes, and then, at the same temperature, 10 ml of chloromethyl methyl ether was added to the reaction liquid, and the reaction liquid was stirred overnight at room temperature. The reaction liquid was diluted with ethyl acetate, and washed with water, and the aqueous layer was extracted with ethyl acetate, and dried with anhydrous magnesium sulfate. The solvent was evaporated away under reduced pressure, and the resulting solid was suspended in hexane and then taken out through filtration to obtain the entitled compound as a white solid.

출처

DOI: 10.6084/m9.figshare.5104873.v1특허: US07728025B2uspto-grants-2010_06